C20H33O4S2+ — CID 90719905
[tert-butyl-(2-cyclohexyl-2-oxoethyl)-methyl-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium (PubChem CID 90719905) has the molecular formula C20H33O4S2+ and a molecular weight of 401.61 g/mol. Its IUPAC name is [tert-butyl-(2-cyclohexyl-2-oxoethyl)-methyl-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium.
| Compound Name | [tert-butyl-(2-cyclohexyl-2-oxoethyl)-methyl-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium |
|---|---|
| PubChem CID | 90719905 |
| Molecular Formula | C20H33O4S2+ |
| Molecular Weight | 401.61 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | [tert-butyl-(2-cyclohexyl-2-oxoethyl)-methyl-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium |
| SMILES | Cc1ccc(S(=O)(=O)[OH+]S(C)(CC(=O)C2CCCCC2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H32O4S2/c1-16-11-13-18(14-12-16)26(22,23)24-25(5,20(2,3)4)15-19(21)17-9-7-6-8-10-17/h11-14,17H,6-10,15H2,1-5H3/p+1 |
| InChIKey | NYFPLNLGLKNZNX-UHFFFAOYSA-O |
| XLogP | 5.07 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|