C19H33O4S2+ — CID 90769038
[(3,3-dimethyl-2-oxobutyl)-di(propan-2-yl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium (PubChem CID 90769038) has the molecular formula C19H33O4S2+ and a molecular weight of 389.60 g/mol. Its IUPAC name is [(3,3-dimethyl-2-oxobutyl)-di(propan-2-yl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium.
| Compound Name | [(3,3-dimethyl-2-oxobutyl)-di(propan-2-yl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium |
|---|---|
| PubChem CID | 90769038 |
| Molecular Formula | C19H33O4S2+ |
| Molecular Weight | 389.60 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | [(3,3-dimethyl-2-oxobutyl)-di(propan-2-yl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium |
| SMILES | Cc1ccc(S(=O)(=O)[OH+]S(CC(=O)C(C)(C)C)(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C19H32O4S2/c1-14(2)24(15(3)4,13-18(20)19(6,7)8)23-25(21,22)17-11-9-16(5)10-12-17/h9-12,14-15H,13H2,1-8H3/p+1 |
| InChIKey | XABOPGBWNDXSDS-UHFFFAOYSA-O |
| XLogP | 4.93 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.60 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|