About [dibutyl(2-oxopropyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium
[dibutyl(2-oxopropyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium (PubChem CID 90703232) has the molecular formula C18H31O4S2+
and a molecular weight of 375.58 g/mol. Its IUPAC name is [dibutyl(2-oxopropyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium.
Molecular Properties
| Compound Name | [dibutyl(2-oxopropyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium |
| PubChem CID | 90703232 |
| Molecular Formula | C18H31O4S2+ |
| Molecular Weight | 375.58 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | [dibutyl(2-oxopropyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium |
| SMILES | CCCCS(CCCC)(CC(C)=O)[OH+]S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H30O4S2/c1-5-7-13-23(14-8-6-2,15-17(4)19)22-24(20,21)18-11-9-16(3)10-12-18/h9-12H,5-8,13-15H2,1-4H3/p+1 |
| InChIKey | NSRYCPHIXFHTHE-UHFFFAOYSA-O |
| XLogP | 4.69 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.58 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [dibutyl(2-oxopropyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dibutyl(2-oxopropyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium?
The IUPAC name of [dibutyl(2-oxopropyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium (CID 90703232) is [dibutyl(2-oxopropyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium.
What is the SMILES notation for [dibutyl(2-oxopropyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium?
The canonical SMILES for [dibutyl(2-oxopropyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium is CCCCS(CCCC)(CC(C)=O)[OH+]S(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of [dibutyl(2-oxopropyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium?
The InChIKey is NSRYCPHIXFHTHE-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H30O4S2/c1-5-7-13-23(14-8-6-2,15-17(4)19)22-24(20,21)18-11-9-16(3)10-12-18/h9-12H,5-8,13-15H2,1-4H3/p+1.
What are the key properties of [dibutyl(2-oxopropyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium?
[dibutyl(2-oxopropyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium has a molecular weight of 375.58 g/mol, XLogP of 4.69, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [dibutyl(2-oxopropyl)-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium is sourced from PubChem (CID 90703232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).