About butylsulfonyl-[diethyl(2-oxopropyl)-λ4-sulfanyl]oxidanium
butylsulfonyl-[diethyl(2-oxopropyl)-λ4-sulfanyl]oxidanium (PubChem CID 91802757) has the molecular formula C11H25O4S2+
and a molecular weight of 285.45 g/mol. Its IUPAC name is butylsulfonyl-[diethyl(2-oxopropyl)-λ4-sulfanyl]oxidanium.
Molecular Properties
| Compound Name | butylsulfonyl-[diethyl(2-oxopropyl)-λ4-sulfanyl]oxidanium |
| PubChem CID | 91802757 |
| Molecular Formula | C11H25O4S2+ |
| Molecular Weight | 285.45 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | butylsulfonyl-[diethyl(2-oxopropyl)-λ4-sulfanyl]oxidanium |
| SMILES | CCCCS(=O)(=O)[OH+]S(CC)(CC)CC(C)=O |
| InChI | InChI=1S/C11H24O4S2/c1-5-8-9-17(13,14)15-16(6-2,7-3)10-11(4)12/h5-10H2,1-4H3/p+1 |
| InChIKey | RUQNHFWJTWUERI-UHFFFAOYSA-O |
| XLogP | 2.56 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze butylsulfonyl-[diethyl(2-oxopropyl)-λ4-sulfanyl]oxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylsulfonyl-[diethyl(2-oxopropyl)-λ4-sulfanyl]oxidanium?
The IUPAC name of butylsulfonyl-[diethyl(2-oxopropyl)-λ4-sulfanyl]oxidanium (CID 91802757) is butylsulfonyl-[diethyl(2-oxopropyl)-λ4-sulfanyl]oxidanium.
What is the SMILES notation for butylsulfonyl-[diethyl(2-oxopropyl)-λ4-sulfanyl]oxidanium?
The canonical SMILES for butylsulfonyl-[diethyl(2-oxopropyl)-λ4-sulfanyl]oxidanium is CCCCS(=O)(=O)[OH+]S(CC)(CC)CC(C)=O.
What is the InChIKey of butylsulfonyl-[diethyl(2-oxopropyl)-λ4-sulfanyl]oxidanium?
The InChIKey is RUQNHFWJTWUERI-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H24O4S2/c1-5-8-9-17(13,14)15-16(6-2,7-3)10-11(4)12/h5-10H2,1-4H3/p+1.
What are the key properties of butylsulfonyl-[diethyl(2-oxopropyl)-λ4-sulfanyl]oxidanium?
butylsulfonyl-[diethyl(2-oxopropyl)-λ4-sulfanyl]oxidanium has a molecular weight of 285.45 g/mol, XLogP of 2.56, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butylsulfonyl-[diethyl(2-oxopropyl)-λ4-sulfanyl]oxidanium is sourced from PubChem (CID 91802757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).