C26H25IO6S2 — CID 90720928
[5,5-bis(benzenesulfonyl)-1-(2-iodophenyl)hex-2-enyl] acetate (PubChem CID 90720928) has the molecular formula C26H25IO6S2 and a molecular weight of 624.52 g/mol. Its IUPAC name is [5,5-bis(benzenesulfonyl)-1-(2-iodophenyl)hex-2-enyl] acetate.
| Compound Name | [5,5-bis(benzenesulfonyl)-1-(2-iodophenyl)hex-2-enyl] acetate |
|---|---|
| PubChem CID | 90720928 |
| Molecular Formula | C26H25IO6S2 |
| Molecular Weight | 624.52 g/mol |
| Exact Mass | 624.01 |
| IUPAC Name | [5,5-bis(benzenesulfonyl)-1-(2-iodophenyl)hex-2-enyl] acetate |
| SMILES | CC(=O)OC(C=CCC(C)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)c1ccccc1I |
| InChI | InChI=1S/C26H25IO6S2/c1-20(28)33-25(23-16-9-10-17-24(23)27)18-11-19-26(2,34(29,30)21-12-5-3-6-13-21)35(31,32)22-14-7-4-8-15-22/h3-18,25H,19H2,1-2H3 |
| InChIKey | YHIKDYVUKZYBLD-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.52 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|