About O-pyridin-2-yl pyrazine-2-carbothioate
O-pyridin-2-yl pyrazine-2-carbothioate (PubChem CID 90721985) has the molecular formula C10H7N3OS
and a molecular weight of 217.25 g/mol. Its IUPAC name is O-pyridin-2-yl pyrazine-2-carbothioate.
Molecular Properties
| Compound Name | O-pyridin-2-yl pyrazine-2-carbothioate |
| PubChem CID | 90721985 |
| Molecular Formula | C10H7N3OS |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | O-pyridin-2-yl pyrazine-2-carbothioate |
| SMILES | S=C(Oc1ccccn1)c1cnccn1 |
| InChI | InChI=1S/C10H7N3OS/c15-10(8-7-11-5-6-12-8)14-9-3-1-2-4-13-9/h1-7H |
| InChIKey | BLTQSYNUVVOPKT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-pyridin-2-yl pyrazine-2-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-pyridin-2-yl pyrazine-2-carbothioate?
The IUPAC name of O-pyridin-2-yl pyrazine-2-carbothioate (CID 90721985) is O-pyridin-2-yl pyrazine-2-carbothioate.
What is the SMILES notation for O-pyridin-2-yl pyrazine-2-carbothioate?
The canonical SMILES for O-pyridin-2-yl pyrazine-2-carbothioate is S=C(Oc1ccccn1)c1cnccn1.
What is the InChIKey of O-pyridin-2-yl pyrazine-2-carbothioate?
The InChIKey is BLTQSYNUVVOPKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3OS/c15-10(8-7-11-5-6-12-8)14-9-3-1-2-4-13-9/h1-7H.
What are the key properties of O-pyridin-2-yl pyrazine-2-carbothioate?
O-pyridin-2-yl pyrazine-2-carbothioate has a molecular weight of 217.25 g/mol, XLogP of 1.63, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for O-pyridin-2-yl pyrazine-2-carbothioate is sourced from PubChem (CID 90721985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).