About O-pyridin-2-yl pyridin-2-ylsulfanylmethanethioate
O-pyridin-2-yl pyridin-2-ylsulfanylmethanethioate (PubChem CID 87588194) has the molecular formula C11H8N2OS2
and a molecular weight of 248.33 g/mol. Its IUPAC name is O-pyridin-2-yl pyridin-2-ylsulfanylmethanethioate.
Molecular Properties
| Compound Name | O-pyridin-2-yl pyridin-2-ylsulfanylmethanethioate |
| PubChem CID | 87588194 |
| Molecular Formula | C11H8N2OS2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | O-pyridin-2-yl pyridin-2-ylsulfanylmethanethioate |
| SMILES | S=C(Oc1ccccn1)Sc1ccccn1 |
| InChI | InChI=1S/C11H8N2OS2/c15-11(14-9-5-1-3-7-12-9)16-10-6-2-4-8-13-10/h1-8H |
| InChIKey | MDKXMTVKJBBBQJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-pyridin-2-yl pyridin-2-ylsulfanylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-pyridin-2-yl pyridin-2-ylsulfanylmethanethioate?
The IUPAC name of O-pyridin-2-yl pyridin-2-ylsulfanylmethanethioate (CID 87588194) is O-pyridin-2-yl pyridin-2-ylsulfanylmethanethioate.
What is the SMILES notation for O-pyridin-2-yl pyridin-2-ylsulfanylmethanethioate?
The canonical SMILES for O-pyridin-2-yl pyridin-2-ylsulfanylmethanethioate is S=C(Oc1ccccn1)Sc1ccccn1.
What is the InChIKey of O-pyridin-2-yl pyridin-2-ylsulfanylmethanethioate?
The InChIKey is MDKXMTVKJBBBQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2OS2/c15-11(14-9-5-1-3-7-12-9)16-10-6-2-4-8-13-10/h1-8H.
What are the key properties of O-pyridin-2-yl pyridin-2-ylsulfanylmethanethioate?
O-pyridin-2-yl pyridin-2-ylsulfanylmethanethioate has a molecular weight of 248.33 g/mol, XLogP of 2.93, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for O-pyridin-2-yl pyridin-2-ylsulfanylmethanethioate is sourced from PubChem (CID 87588194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).