C18H23F3N2O5S — CID 90725013
N-(oxan-2-ylmethoxy)-1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-amine (PubChem CID 90725013) has the molecular formula C18H23F3N2O5S and a molecular weight of 436.45 g/mol. Its IUPAC name is N-(oxan-2-ylmethoxy)-1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-amine.
| Compound Name | N-(oxan-2-ylmethoxy)-1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-amine |
|---|---|
| PubChem CID | 90725013 |
| Molecular Formula | C18H23F3N2O5S |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | N-(oxan-2-ylmethoxy)-1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-amine |
| SMILES | O=S(=O)(c1ccc(OC(F)(F)F)cc1)N1CC=C(NOCC2CCCCO2)CC1 |
| InChI | InChI=1S/C18H23F3N2O5S/c19-18(20,21)28-15-4-6-17(7-5-15)29(24,25)23-10-8-14(9-11-23)22-27-13-16-3-1-2-12-26-16/h4-8,16,22H,1-3,9-13H2 |
| InChIKey | AARQHAXLKQSVNM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|