C20H21F3N2O4S — CID 90703266
1-(4-methoxyphenyl)sulfonyl-N-[[3-(trifluoromethyl)phenyl]methoxy]-3,6-dihydro-2H-pyridin-4-amine (PubChem CID 90703266) has the molecular formula C20H21F3N2O4S and a molecular weight of 442.46 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)sulfonyl-N-[[3-(trifluoromethyl)phenyl]methoxy]-3,6-dihydro-2H-pyridin-4-amine.
| Compound Name | 1-(4-methoxyphenyl)sulfonyl-N-[[3-(trifluoromethyl)phenyl]methoxy]-3,6-dihydro-2H-pyridin-4-amine |
|---|---|
| PubChem CID | 90703266 |
| Molecular Formula | C20H21F3N2O4S |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 1-(4-methoxyphenyl)sulfonyl-N-[[3-(trifluoromethyl)phenyl]methoxy]-3,6-dihydro-2H-pyridin-4-amine |
| SMILES | COc1ccc(S(=O)(=O)N2CC=C(NOCc3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C20H21F3N2O4S/c1-28-18-5-7-19(8-6-18)30(26,27)25-11-9-17(10-12-25)24-29-14-15-3-2-4-16(13-15)20(21,22)23/h2-9,13,24H,10-12,14H2,1H3 |
| InChIKey | LVDHEDRROYABGQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|