C21H20F3N3O5S — CID 90784697
3-[2-hydroxy-1-[[1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxyethyl]benzonitrile (PubChem CID 90784697) has the molecular formula C21H20F3N3O5S and a molecular weight of 483.47 g/mol. Its IUPAC name is 3-[2-hydroxy-1-[[1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxyethyl]benzonitrile.
| Compound Name | 3-[2-hydroxy-1-[[1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxyethyl]benzonitrile |
|---|---|
| PubChem CID | 90784697 |
| Molecular Formula | C21H20F3N3O5S |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 3-[2-hydroxy-1-[[1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxyethyl]benzonitrile |
| SMILES | N#Cc1cccc(C(CO)ONC2=CCN(S(=O)(=O)c3ccc(OC(F)(F)F)cc3)CC2)c1 |
| InChI | InChI=1S/C21H20F3N3O5S/c22-21(23,24)31-18-4-6-19(7-5-18)33(29,30)27-10-8-17(9-11-27)26-32-20(14-28)16-3-1-2-15(12-16)13-25/h1-8,12,20,26,28H,9-11,14H2 |
| InChIKey | VBZSHUROELVCRE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|