C23H25F3N2O4S — CID 90691905
1-[4-(cyclopropylmethoxy)phenyl]sulfonyl-N-[[3-(trifluoromethyl)phenyl]methoxy]-3,6-dihydro-2H-pyridin-4-amine (PubChem CID 90691905) has the molecular formula C23H25F3N2O4S and a molecular weight of 482.52 g/mol. Its IUPAC name is 1-[4-(cyclopropylmethoxy)phenyl]sulfonyl-N-[[3-(trifluoromethyl)phenyl]methoxy]-3,6-dihydro-2H-pyridin-4-amine.
| Compound Name | 1-[4-(cyclopropylmethoxy)phenyl]sulfonyl-N-[[3-(trifluoromethyl)phenyl]methoxy]-3,6-dihydro-2H-pyridin-4-amine |
|---|---|
| PubChem CID | 90691905 |
| Molecular Formula | C23H25F3N2O4S |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 1-[4-(cyclopropylmethoxy)phenyl]sulfonyl-N-[[3-(trifluoromethyl)phenyl]methoxy]-3,6-dihydro-2H-pyridin-4-amine |
| SMILES | O=S(=O)(c1ccc(OCC2CC2)cc1)N1CC=C(NOCc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C23H25F3N2O4S/c24-23(25,26)19-3-1-2-18(14-19)16-32-27-20-10-12-28(13-11-20)33(29,30)22-8-6-21(7-9-22)31-15-17-4-5-17/h1-3,6-10,14,17,27H,4-5,11-13,15-16H2 |
| InChIKey | ZICISLOFUPJWPU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|