C23H33N3O5 — CID 90725463
3-(2,5-dioxopyrrol-1-yl)-N-methylpropanamide;N-(hydroxymethyl)-4-(4-methylphenyl)-N-propylbutanamide (PubChem CID 90725463) has the molecular formula C23H33N3O5 and a molecular weight of 431.53 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-methylpropanamide;N-(hydroxymethyl)-4-(4-methylphenyl)-N-propylbutanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-methylpropanamide;N-(hydroxymethyl)-4-(4-methylphenyl)-N-propylbutanamide |
|---|---|
| PubChem CID | 90725463 |
| Molecular Formula | C23H33N3O5 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-methylpropanamide;N-(hydroxymethyl)-4-(4-methylphenyl)-N-propylbutanamide |
| SMILES | CCCN(CO)C(=O)CCCc1ccc(C)cc1.CNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C15H23NO2.C8H10N2O3/c1-3-11-16(12-17)15(18)6-4-5-14-9-7-13(2)8-10-14;1-9-6(11)4-5-10-7(12)2-3-8(10)13/h7-10,17H,3-6,11-12H2,1-2H3;2-3H,4-5H2,1H3,(H,9,11) |
| InChIKey | IHRNAWHIZWHDNA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|