C18H25F2N3O4 — CID 146148834
N-[(2,2-difluorocyclopentyl)methyl]-5-(2,5-dioxopyrrol-1-yl)-N-[2-(methylamino)-2-oxoethyl]pentanamide (PubChem CID 146148834) has the molecular formula C18H25F2N3O4 and a molecular weight of 385.41 g/mol. Its IUPAC name is N-[(2,2-difluorocyclopentyl)methyl]-5-(2,5-dioxopyrrol-1-yl)-N-[2-(methylamino)-2-oxoethyl]pentanamide.
| Compound Name | N-[(2,2-difluorocyclopentyl)methyl]-5-(2,5-dioxopyrrol-1-yl)-N-[2-(methylamino)-2-oxoethyl]pentanamide |
|---|---|
| PubChem CID | 146148834 |
| Molecular Formula | C18H25F2N3O4 |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-[(2,2-difluorocyclopentyl)methyl]-5-(2,5-dioxopyrrol-1-yl)-N-[2-(methylamino)-2-oxoethyl]pentanamide |
| SMILES | CNC(=O)CN(CC1CCCC1(F)F)C(=O)CCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C18H25F2N3O4/c1-21-14(24)12-22(11-13-5-4-9-18(13,19)20)15(25)6-2-3-10-23-16(26)7-8-17(23)27/h7-8,13H,2-6,9-12H2,1H3,(H,21,24) |
| InChIKey | ZCGDOPZFCULTSV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|