C11H17O3- — CID 90726138
3-ethyl-1,2,6-trimethoxycyclohexa-1,3-diene (PubChem CID 90726138) has the molecular formula C11H17O3- and a molecular weight of 197.25 g/mol. Its IUPAC name is 3-ethyl-1,2,6-trimethoxycyclohexa-1,3-diene.
| Compound Name | 3-ethyl-1,2,6-trimethoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 90726138 |
| Molecular Formula | C11H17O3- |
| Molecular Weight | 197.25 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 3-ethyl-1,2,6-trimethoxycyclohexa-1,3-diene |
| SMILES | C[CH-]C1=CCC(OC)C(OC)=C1OC |
| InChI | InChI=1S/C11H17O3/c1-5-8-6-7-9(12-2)11(14-4)10(8)13-3/h5-6,9H,7H2,1-4H3/q-1 |
| InChIKey | VTCIJEKIAVMPPV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|