C21H20F6N4O — CID 90729707
N-[3,5-bis(trifluoromethyl)phenyl]-N-[3-(dimethylamino)propoxy]quinazolin-2-amine (PubChem CID 90729707) has the molecular formula C21H20F6N4O and a molecular weight of 458.41 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-N-[3-(dimethylamino)propoxy]quinazolin-2-amine.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-N-[3-(dimethylamino)propoxy]quinazolin-2-amine |
|---|---|
| PubChem CID | 90729707 |
| Molecular Formula | C21H20F6N4O |
| Molecular Weight | 458.41 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-N-[3-(dimethylamino)propoxy]quinazolin-2-amine |
| SMILES | CN(C)CCCON(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ncc2ccccc2n1 |
| InChI | InChI=1S/C21H20F6N4O/c1-30(2)8-5-9-32-31(19-28-13-14-6-3-4-7-18(14)29-19)17-11-15(20(22,23)24)10-16(12-17)21(25,26)27/h3-4,6-7,10-13H,5,8-9H2,1-2H3 |
| InChIKey | UGFOIJBOOJGFIH-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.41 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|