C34H32FN2O4- — CID 90731398
1-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[4-(4-fluorophenoxy)anilino]-5-oxo-4-(phenylmethoxymethyl)pent-2-en-2-olate (PubChem CID 90731398) has the molecular formula C34H32FN2O4- and a molecular weight of 551.64 g/mol. Its IUPAC name is 1-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[4-(4-fluorophenoxy)anilino]-5-oxo-4-(phenylmethoxymethyl)pent-2-en-2-olate.
| Compound Name | 1-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[4-(4-fluorophenoxy)anilino]-5-oxo-4-(phenylmethoxymethyl)pent-2-en-2-olate |
|---|---|
| PubChem CID | 90731398 |
| Molecular Formula | C34H32FN2O4- |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | 1-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[4-(4-fluorophenoxy)anilino]-5-oxo-4-(phenylmethoxymethyl)pent-2-en-2-olate |
| SMILES | O=C(Nc1ccc(Oc2ccc(F)cc2)cc1)C(C=C([O-])CN1CCc2ccccc2C1)COCc1ccccc1 |
| InChI | InChI=1S/C34H33FN2O4/c35-29-10-14-32(15-11-29)41-33-16-12-30(13-17-33)36-34(39)28(24-40-23-25-6-2-1-3-7-25)20-31(38)22-37-19-18-26-8-4-5-9-27(26)21-37/h1-17,20,28,38H,18-19,21-24H2,(H,36,39)/p-1 |
| InChIKey | KSZJYIOFAHPKSK-UHFFFAOYSA-M |
| XLogP | 5.69 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|