C23H23BrN6OS — CID 90731435
1-[3-[[3-(3H-benzimidazol-5-yl)-4-(4-bromophenyl)-2-sulfanylidene-1H-imidazol-5-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 90731435) has the molecular formula C23H23BrN6OS and a molecular weight of 511.45 g/mol. Its IUPAC name is 1-[3-[[3-(3H-benzimidazol-5-yl)-4-(4-bromophenyl)-2-sulfanylidene-1H-imidazol-5-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[3-(3H-benzimidazol-5-yl)-4-(4-bromophenyl)-2-sulfanylidene-1H-imidazol-5-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 90731435 |
| Molecular Formula | C23H23BrN6OS |
| Molecular Weight | 511.45 g/mol |
| Exact Mass | 510.08 |
| IUPAC Name | 1-[3-[[3-(3H-benzimidazol-5-yl)-4-(4-bromophenyl)-2-sulfanylidene-1H-imidazol-5-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCCNc1[nH]c(=S)n(-c2ccc3nc[nH]c3c2)c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H23BrN6OS/c24-16-6-4-15(5-7-16)21-22(25-10-2-12-29-11-1-3-20(29)31)28-23(32)30(21)17-8-9-18-19(13-17)27-14-26-18/h4-9,13-14,25H,1-3,10-12H2,(H,26,27)(H,28,32) |
| InChIKey | NAZUOBUYALPXNH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 81.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.45 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|