C20H19N5O2S — CID 91381695
methyl 2-[[3-(3H-benzimidazol-5-yl)-4-phenyl-2-sulfanylidene-1H-imidazol-5-yl]amino]propanoate (PubChem CID 91381695) has the molecular formula C20H19N5O2S and a molecular weight of 393.47 g/mol. Its IUPAC name is methyl 2-[[3-(3H-benzimidazol-5-yl)-4-phenyl-2-sulfanylidene-1H-imidazol-5-yl]amino]propanoate.
| Compound Name | methyl 2-[[3-(3H-benzimidazol-5-yl)-4-phenyl-2-sulfanylidene-1H-imidazol-5-yl]amino]propanoate |
|---|---|
| PubChem CID | 91381695 |
| Molecular Formula | C20H19N5O2S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | methyl 2-[[3-(3H-benzimidazol-5-yl)-4-phenyl-2-sulfanylidene-1H-imidazol-5-yl]amino]propanoate |
| SMILES | COC(=O)C(C)Nc1[nH]c(=S)n(-c2ccc3nc[nH]c3c2)c1-c1ccccc1 |
| InChI | InChI=1S/C20H19N5O2S/c1-12(19(26)27-2)23-18-17(13-6-4-3-5-7-13)25(20(28)24-18)14-8-9-15-16(10-14)22-11-21-15/h3-12,23H,1-2H3,(H,21,22)(H,24,28) |
| InChIKey | CNWSDOURSJTUIS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 87.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|