C28H29F2N5O3 — CID 90731470
6-cyclopentyl-6-[2-[3,5-difluoro-4-(2-isocyanopropan-2-yl)phenyl]ethyl]-3-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylmethyl)oxane-2,4-dione (PubChem CID 90731470) has the molecular formula C28H29F2N5O3 and a molecular weight of 521.57 g/mol. Its IUPAC name is 6-cyclopentyl-6-[2-[3,5-difluoro-4-(2-isocyanopropan-2-yl)phenyl]ethyl]-3-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylmethyl)oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-6-[2-[3,5-difluoro-4-(2-isocyanopropan-2-yl)phenyl]ethyl]-3-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylmethyl)oxane-2,4-dione |
|---|---|
| PubChem CID | 90731470 |
| Molecular Formula | C28H29F2N5O3 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 6-cyclopentyl-6-[2-[3,5-difluoro-4-(2-isocyanopropan-2-yl)phenyl]ethyl]-3-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylmethyl)oxane-2,4-dione |
| SMILES | [C-]#[N+]C(C)(C)c1c(F)cc(CCC2(C3CCCC3)CC(=O)C(Cc3nc4ncccn4n3)C(=O)O2)cc1F |
| InChI | InChI=1S/C28H29F2N5O3/c1-27(2,31-3)24-20(29)13-17(14-21(24)30)9-10-28(18-7-4-5-8-18)16-22(36)19(25(37)38-28)15-23-33-26-32-11-6-12-35(26)34-23/h6,11-14,18-19H,4-5,7-10,15-16H2,1-2H3 |
| InChIKey | XIKAKVVZHHNOND-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 90.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|