C19H17F2N3O3S — CID 90735741
3-[[[1-(3,5-difluorophenyl)sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]benzonitrile (PubChem CID 90735741) has the molecular formula C19H17F2N3O3S and a molecular weight of 405.43 g/mol. Its IUPAC name is 3-[[[1-(3,5-difluorophenyl)sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]benzonitrile.
| Compound Name | 3-[[[1-(3,5-difluorophenyl)sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]benzonitrile |
|---|---|
| PubChem CID | 90735741 |
| Molecular Formula | C19H17F2N3O3S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 3-[[[1-(3,5-difluorophenyl)sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]benzonitrile |
| SMILES | N#Cc1cccc(CONC2=CCN(S(=O)(=O)c3cc(F)cc(F)c3)CC2)c1 |
| InChI | InChI=1S/C19H17F2N3O3S/c20-16-9-17(21)11-19(10-16)28(25,26)24-6-4-18(5-7-24)23-27-13-15-3-1-2-14(8-15)12-22/h1-4,8-11,23H,5-7,13H2 |
| InChIKey | RAELMRSQMLGXPG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|