C25H21F2N3O3S — CID 90879984
3-[[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]benzonitrile (PubChem CID 90879984) has the molecular formula C25H21F2N3O3S and a molecular weight of 481.52 g/mol. Its IUPAC name is 3-[[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]benzonitrile.
| Compound Name | 3-[[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]benzonitrile |
|---|---|
| PubChem CID | 90879984 |
| Molecular Formula | C25H21F2N3O3S |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 3-[[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]benzonitrile |
| SMILES | N#Cc1cccc(S(=O)(=O)N2CC=C(NOC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C25H21F2N3O3S/c26-21-8-4-19(5-9-21)25(20-6-10-22(27)11-7-20)33-29-23-12-14-30(15-13-23)34(31,32)24-3-1-2-18(16-24)17-28/h1-12,16,25,29H,13-15H2 |
| InChIKey | GCZVXSVHKCIRPP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|