C23H27F3N2O3S — CID 90885859
1-(4-butylphenyl)sulfonyl-N-[[3-(trifluoromethyl)phenyl]methoxy]-3,6-dihydro-2H-pyridin-4-amine (PubChem CID 90885859) has the molecular formula C23H27F3N2O3S and a molecular weight of 468.54 g/mol. Its IUPAC name is 1-(4-butylphenyl)sulfonyl-N-[[3-(trifluoromethyl)phenyl]methoxy]-3,6-dihydro-2H-pyridin-4-amine.
| Compound Name | 1-(4-butylphenyl)sulfonyl-N-[[3-(trifluoromethyl)phenyl]methoxy]-3,6-dihydro-2H-pyridin-4-amine |
|---|---|
| PubChem CID | 90885859 |
| Molecular Formula | C23H27F3N2O3S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 1-(4-butylphenyl)sulfonyl-N-[[3-(trifluoromethyl)phenyl]methoxy]-3,6-dihydro-2H-pyridin-4-amine |
| SMILES | CCCCc1ccc(S(=O)(=O)N2CC=C(NOCc3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C23H27F3N2O3S/c1-2-3-5-18-8-10-22(11-9-18)32(29,30)28-14-12-21(13-15-28)27-31-17-19-6-4-7-20(16-19)23(24,25)26/h4,6-12,16,27H,2-3,5,13-15,17H2,1H3 |
| InChIKey | FFEORCKDOBSANY-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|