C21H21F3N2O4S — CID 90722374
1-[4-[[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]phenyl]ethanone (PubChem CID 90722374) has the molecular formula C21H21F3N2O4S and a molecular weight of 454.47 g/mol. Its IUPAC name is 1-[4-[[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]phenyl]ethanone.
| Compound Name | 1-[4-[[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]phenyl]ethanone |
|---|---|
| PubChem CID | 90722374 |
| Molecular Formula | C21H21F3N2O4S |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 1-[4-[[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CC=C(NOCc3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C21H21F3N2O4S/c1-15(27)17-5-7-20(8-6-17)31(28,29)26-11-9-19(10-12-26)25-30-14-16-3-2-4-18(13-16)21(22,23)24/h2-9,13,25H,10-12,14H2,1H3 |
| InChIKey | FUVZOQGUEBHKQX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|