C24H29F3N2O3S — CID 90820274
1-(4-butylphenyl)sulfonyl-N-[1-[3-(trifluoromethyl)phenyl]ethoxy]-3,6-dihydro-2H-pyridin-4-amine (PubChem CID 90820274) has the molecular formula C24H29F3N2O3S and a molecular weight of 482.57 g/mol. Its IUPAC name is 1-(4-butylphenyl)sulfonyl-N-[1-[3-(trifluoromethyl)phenyl]ethoxy]-3,6-dihydro-2H-pyridin-4-amine.
| Compound Name | 1-(4-butylphenyl)sulfonyl-N-[1-[3-(trifluoromethyl)phenyl]ethoxy]-3,6-dihydro-2H-pyridin-4-amine |
|---|---|
| PubChem CID | 90820274 |
| Molecular Formula | C24H29F3N2O3S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 1-(4-butylphenyl)sulfonyl-N-[1-[3-(trifluoromethyl)phenyl]ethoxy]-3,6-dihydro-2H-pyridin-4-amine |
| SMILES | CCCCc1ccc(S(=O)(=O)N2CC=C(NOC(C)c3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C24H29F3N2O3S/c1-3-4-6-19-9-11-23(12-10-19)33(30,31)29-15-13-22(14-16-29)28-32-18(2)20-7-5-8-21(17-20)24(25,26)27/h5,7-13,17-18,28H,3-4,6,14-16H2,1-2H3 |
| InChIKey | JMHKAKSDCCIXNH-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|