C19H18F4N2O3S — CID 90792190
1-(4-fluorophenyl)sulfonyl-N-[[3-(trifluoromethyl)phenyl]methoxy]-3,6-dihydro-2H-pyridin-4-amine (PubChem CID 90792190) has the molecular formula C19H18F4N2O3S and a molecular weight of 430.42 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-N-[[3-(trifluoromethyl)phenyl]methoxy]-3,6-dihydro-2H-pyridin-4-amine.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-N-[[3-(trifluoromethyl)phenyl]methoxy]-3,6-dihydro-2H-pyridin-4-amine |
|---|---|
| PubChem CID | 90792190 |
| Molecular Formula | C19H18F4N2O3S |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-N-[[3-(trifluoromethyl)phenyl]methoxy]-3,6-dihydro-2H-pyridin-4-amine |
| SMILES | O=S(=O)(c1ccc(F)cc1)N1CC=C(NOCc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H18F4N2O3S/c20-16-4-6-18(7-5-16)29(26,27)25-10-8-17(9-11-25)24-28-13-14-2-1-3-15(12-14)19(21,22)23/h1-8,12,24H,9-11,13H2 |
| InChIKey | IOLSUTCFCAAASC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|