C20H18F6N2O3S — CID 90912126
N-[[3-(trifluoromethyl)phenyl]methoxy]-1-[2-(trifluoromethyl)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-amine (PubChem CID 90912126) has the molecular formula C20H18F6N2O3S and a molecular weight of 480.43 g/mol. Its IUPAC name is N-[[3-(trifluoromethyl)phenyl]methoxy]-1-[2-(trifluoromethyl)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-amine.
| Compound Name | N-[[3-(trifluoromethyl)phenyl]methoxy]-1-[2-(trifluoromethyl)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-amine |
|---|---|
| PubChem CID | 90912126 |
| Molecular Formula | C20H18F6N2O3S |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | N-[[3-(trifluoromethyl)phenyl]methoxy]-1-[2-(trifluoromethyl)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-amine |
| SMILES | O=S(=O)(c1ccccc1C(F)(F)F)N1CC=C(NOCc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H18F6N2O3S/c21-19(22,23)15-5-3-4-14(12-15)13-31-27-16-8-10-28(11-9-16)32(29,30)18-7-2-1-6-17(18)20(24,25)26/h1-8,12,27H,9-11,13H2 |
| InChIKey | ZHUJLNROPCNCNJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|