C26H24F2N2O5S — CID 91499481
methyl 3-[[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]benzoate (PubChem CID 91499481) has the molecular formula C26H24F2N2O5S and a molecular weight of 514.55 g/mol. Its IUPAC name is methyl 3-[[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]benzoate.
| Compound Name | methyl 3-[[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]benzoate |
|---|---|
| PubChem CID | 91499481 |
| Molecular Formula | C26H24F2N2O5S |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | methyl 3-[[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]benzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)N2CC=C(NOC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C26H24F2N2O5S/c1-34-26(31)20-3-2-4-24(17-20)36(32,33)30-15-13-23(14-16-30)29-35-25(18-5-9-21(27)10-6-18)19-7-11-22(28)12-8-19/h2-13,17,25,29H,14-16H2,1H3 |
| InChIKey | NYSKKSCIILIDLX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|