C25H23F2N3O4S — CID 91137268
3-[[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]benzamide (PubChem CID 91137268) has the molecular formula C25H23F2N3O4S and a molecular weight of 499.54 g/mol. Its IUPAC name is 3-[[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]benzamide.
| Compound Name | 3-[[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]benzamide |
|---|---|
| PubChem CID | 91137268 |
| Molecular Formula | C25H23F2N3O4S |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | 3-[[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]benzamide |
| SMILES | NC(=O)c1cccc(S(=O)(=O)N2CC=C(NOC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C25H23F2N3O4S/c26-20-8-4-17(5-9-20)24(18-6-10-21(27)11-7-18)34-29-22-12-14-30(15-13-22)35(32,33)23-3-1-2-19(16-23)25(28)31/h1-12,16,24,29H,13-15H2,(H2,28,31) |
| InChIKey | HVJXSWZKIREEFD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|