C16H28N2 — CID 90735926
N-ethyl-4-methyl-N-(2-pyrrolidin-1-ylethyl)hepta-2,4,6-trien-2-amine (PubChem CID 90735926) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is N-ethyl-4-methyl-N-(2-pyrrolidin-1-ylethyl)hepta-2,4,6-trien-2-amine.
| Compound Name | N-ethyl-4-methyl-N-(2-pyrrolidin-1-ylethyl)hepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 90735926 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | N-ethyl-4-methyl-N-(2-pyrrolidin-1-ylethyl)hepta-2,4,6-trien-2-amine |
| SMILES | C=CC=C(C)C=C(C)N(CC)CCN1CCCC1 |
| InChI | InChI=1S/C16H28N2/c1-5-9-15(3)14-16(4)18(6-2)13-12-17-10-7-8-11-17/h5,9,14H,1,6-8,10-13H2,2-4H3 |
| InChIKey | HPUUWWCKUKYDTR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|