C32H39NO7S — CID 90736205
(2R,4R,4aR,5aR,11aS,12aR)-7-(2-ethylsulfanylphenyl)-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 90736205) has the molecular formula C32H39NO7S and a molecular weight of 581.73 g/mol. Its IUPAC name is (2R,4R,4aR,5aR,11aS,12aR)-7-(2-ethylsulfanylphenyl)-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (2R,4R,4aR,5aR,11aS,12aR)-7-(2-ethylsulfanylphenyl)-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 90736205 |
| Molecular Formula | C32H39NO7S |
| Molecular Weight | 581.73 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | (2R,4R,4aR,5aR,11aS,12aR)-7-(2-ethylsulfanylphenyl)-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CCSc1ccccc1-c1ccc(O)c2c1C[C@]1(C)C[C@]3(C)[C@@H](C(C)C)C(O)[C@@H](C(N)=O)C(=O)[C@]3(O)C(O)[C@H]1C2=O |
| InChI | InChI=1S/C32H39NO7S/c1-6-41-20-10-8-7-9-17(20)16-11-12-19(34)21-18(16)13-30(4)14-31(5)23(15(2)3)26(36)22(29(33)39)27(37)32(31,40)28(38)24(30)25(21)35/h7-12,15,22-24,26,28,34,36,38,40H,6,13-14H2,1-5H3,(H2,33,39)/t22-,23+,24-,26?,28?,30-,31-,32+/m1/s1 |
| InChIKey | LCAYJGMZLAARLE-WKYDJEAJSA-N |
| XLogP | 3.35 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.73 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|