C29H32ClNO9 — CID 91311915
2-[(5aS,6aR,8R,10R,10aR,11aR)-8-carbamoyl-4,6,6a,9-tetrahydroxy-10a,11a-dimethyl-5,7-dioxo-10-propan-2-yl-6,8,9,10,11,12-hexahydro-5aH-tetracen-1-yl]furan-3-carbonyl chloride (PubChem CID 91311915) has the molecular formula C29H32ClNO9 and a molecular weight of 574.03 g/mol. Its IUPAC name is 2-[(5aS,6aR,8R,10R,10aR,11aR)-8-carbamoyl-4,6,6a,9-tetrahydroxy-10a,11a-dimethyl-5,7-dioxo-10-propan-2-yl-6,8,9,10,11,12-hexahydro-5aH-tetracen-1-yl]furan-3-carbonyl chloride.
| Compound Name | 2-[(5aS,6aR,8R,10R,10aR,11aR)-8-carbamoyl-4,6,6a,9-tetrahydroxy-10a,11a-dimethyl-5,7-dioxo-10-propan-2-yl-6,8,9,10,11,12-hexahydro-5aH-tetracen-1-yl]furan-3-carbonyl chloride |
|---|---|
| PubChem CID | 91311915 |
| Molecular Formula | C29H32ClNO9 |
| Molecular Weight | 574.03 g/mol |
| Exact Mass | 573.18 |
| IUPAC Name | 2-[(5aS,6aR,8R,10R,10aR,11aR)-8-carbamoyl-4,6,6a,9-tetrahydroxy-10a,11a-dimethyl-5,7-dioxo-10-propan-2-yl-6,8,9,10,11,12-hexahydro-5aH-tetracen-1-yl]furan-3-carbonyl chloride |
| SMILES | CC(C)[C@H]1C(O)[C@@H](C(N)=O)C(=O)[C@]2(O)C(O)[C@H]3C(=O)c4c(O)ccc(-c5occc5C(=O)Cl)c4C[C@]3(C)C[C@]12C |
| InChI | InChI=1S/C29H32ClNO9/c1-11(2)18-21(34)17(26(31)38)23(35)29(39)24(36)19-20(33)16-14(9-27(19,3)10-28(18,29)4)12(5-6-15(16)32)22-13(25(30)37)7-8-40-22/h5-8,11,17-19,21,24,32,34,36,39H,9-10H2,1-4H3,(H2,31,38)/t17-,18+,19-,21?,24?,27-,28-,29+/m1/s1 |
| InChIKey | UBNVVEQHJRYHCH-YMJWVKFUSA-N |
| XLogP | 2.21 |
| TPSA | 188.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.03 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|