C33H41NO10 — CID 91390057
(2R,4R,4aR,5aR,11aS,12aR)-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-7-(3,4,5-trimethoxyphenyl)-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 91390057) has the molecular formula C33H41NO10 and a molecular weight of 611.69 g/mol. Its IUPAC name is (2R,4R,4aR,5aR,11aS,12aR)-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-7-(3,4,5-trimethoxyphenyl)-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (2R,4R,4aR,5aR,11aS,12aR)-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-7-(3,4,5-trimethoxyphenyl)-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91390057 |
| Molecular Formula | C33H41NO10 |
| Molecular Weight | 611.69 g/mol |
| Exact Mass | 611.27 |
| IUPAC Name | (2R,4R,4aR,5aR,11aS,12aR)-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-7-(3,4,5-trimethoxyphenyl)-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | COc1cc(-c2ccc(O)c3c2C[C@]2(C)C[C@]4(C)[C@@H](C(C)C)C(O)[C@@H](C(N)=O)C(=O)[C@]4(O)C(O)[C@H]2C3=O)cc(OC)c1OC |
| InChI | InChI=1S/C33H41NO10/c1-14(2)23-26(37)22(30(34)40)28(38)33(41)29(39)24-25(36)21-17(12-31(24,3)13-32(23,33)4)16(8-9-18(21)35)15-10-19(42-5)27(44-7)20(11-15)43-6/h8-11,14,22-24,26,29,35,37,39,41H,12-13H2,1-7H3,(H2,34,40)/t22-,23+,24-,26?,29?,31-,32-,33+/m1/s1 |
| InChIKey | RRJCGLOJROTAOL-UNAAYFQISA-N |
| XLogP | 2.27 |
| TPSA | 185.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.69 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|