C30H43NO7 — CID 91444503
(2R,4R,4aR,5aR,11aS,12aR)-7-(3,3-dimethylbutyl)-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 91444503) has the molecular formula C30H43NO7 and a molecular weight of 529.67 g/mol. Its IUPAC name is (2R,4R,4aR,5aR,11aS,12aR)-7-(3,3-dimethylbutyl)-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (2R,4R,4aR,5aR,11aS,12aR)-7-(3,3-dimethylbutyl)-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91444503 |
| Molecular Formula | C30H43NO7 |
| Molecular Weight | 529.67 g/mol |
| Exact Mass | 529.30 |
| IUPAC Name | (2R,4R,4aR,5aR,11aS,12aR)-7-(3,3-dimethylbutyl)-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CC(C)[C@H]1C(O)[C@@H](C(N)=O)C(=O)[C@]2(O)C(O)[C@H]3C(=O)c4c(O)ccc(CCC(C)(C)C)c4C[C@]3(C)C[C@]12C |
| InChI | InChI=1S/C30H43NO7/c1-14(2)20-23(34)19(26(31)37)24(35)30(38)25(36)21-22(33)18-16(12-28(21,6)13-29(20,30)7)15(8-9-17(18)32)10-11-27(3,4)5/h8-9,14,19-21,23,25,32,34,36,38H,10-13H2,1-7H3,(H2,31,37)/t19-,20+,21-,23?,25?,28-,29-,30+/m1/s1 |
| InChIKey | DSFIHTOQGBFFPO-VTOGNPRZSA-N |
| XLogP | 2.55 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.67 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|