C30H42N2O9 — CID 91184415
2-methylpropyl N-[[(5aS,6aR,8R,10R,10aR,11aR)-8-carbamoyl-4,6,6a,9-tetrahydroxy-10a,11a-dimethyl-5,7-dioxo-10-propan-2-yl-6,8,9,10,11,12-hexahydro-5aH-tetracen-1-yl]methyl]carbamate (PubChem CID 91184415) has the molecular formula C30H42N2O9 and a molecular weight of 574.67 g/mol. Its IUPAC name is 2-methylpropyl N-[[(5aS,6aR,8R,10R,10aR,11aR)-8-carbamoyl-4,6,6a,9-tetrahydroxy-10a,11a-dimethyl-5,7-dioxo-10-propan-2-yl-6,8,9,10,11,12-hexahydro-5aH-tetracen-1-yl]methyl]carbamate.
| Compound Name | 2-methylpropyl N-[[(5aS,6aR,8R,10R,10aR,11aR)-8-carbamoyl-4,6,6a,9-tetrahydroxy-10a,11a-dimethyl-5,7-dioxo-10-propan-2-yl-6,8,9,10,11,12-hexahydro-5aH-tetracen-1-yl]methyl]carbamate |
|---|---|
| PubChem CID | 91184415 |
| Molecular Formula | C30H42N2O9 |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | 2-methylpropyl N-[[(5aS,6aR,8R,10R,10aR,11aR)-8-carbamoyl-4,6,6a,9-tetrahydroxy-10a,11a-dimethyl-5,7-dioxo-10-propan-2-yl-6,8,9,10,11,12-hexahydro-5aH-tetracen-1-yl]methyl]carbamate |
| SMILES | CC(C)COC(=O)NCc1ccc(O)c2c1C[C@]1(C)C[C@]3(C)[C@@H](C(C)C)C(O)[C@@H](C(N)=O)C(=O)[C@]3(O)C(O)[C@H]1C2=O |
| InChI | InChI=1S/C30H42N2O9/c1-13(2)11-41-27(39)32-10-15-7-8-17(33)18-16(15)9-28(5)12-29(6)20(14(3)4)23(35)19(26(31)38)24(36)30(29,40)25(37)21(28)22(18)34/h7-8,13-14,19-21,23,25,33,35,37,40H,9-12H2,1-6H3,(H2,31,38)(H,32,39)/t19-,20+,21-,23?,25?,28-,29-,30+/m1/s1 |
| InChIKey | WSGOFORBMPYCGY-VTOGNPRZSA-N |
| XLogP | 1.46 |
| TPSA | 196.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|