C9H12BrN — CID 90739036
4-bromo-6,6-dimethylcyclohepta-2,4-dien-1-imine (PubChem CID 90739036) has the molecular formula C9H12BrN and a molecular weight of 214.11 g/mol. Its IUPAC name is 4-bromo-6,6-dimethylcyclohepta-2,4-dien-1-imine.
| Compound Name | 4-bromo-6,6-dimethylcyclohepta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 90739036 |
| Molecular Formula | C9H12BrN |
| Molecular Weight | 214.11 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | 4-bromo-6,6-dimethylcyclohepta-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=CC(Br)=CC(C)(C)C1 |
| InChI | InChI=1S/C9H12BrN/c1-9(2)5-7(10)3-4-8(11)6-9/h3-5,11H,6H2,1-2H3/b11-8+ |
| InChIKey | MEVCZFUPMQUIME-DHZHZOJOSA-N |
| XLogP | 3.27 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.11 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|