C14H24BN — CID 90770773
4-[ethyl(propan-2-yl)boranyl]-6,6-dimethylcyclohepta-2,4-dien-1-imine (PubChem CID 90770773) has the molecular formula C14H24BN and a molecular weight of 217.16 g/mol. Its IUPAC name is 4-[ethyl(propan-2-yl)boranyl]-6,6-dimethylcyclohepta-2,4-dien-1-imine.
| Compound Name | 4-[ethyl(propan-2-yl)boranyl]-6,6-dimethylcyclohepta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 90770773 |
| Molecular Formula | C14H24BN |
| Molecular Weight | 217.16 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | 4-[ethyl(propan-2-yl)boranyl]-6,6-dimethylcyclohepta-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=CC(B(CC)C(C)C)=CC(C)(C)C1 |
| InChI | InChI=1S/C14H24BN/c1-6-15(11(2)3)12-7-8-13(16)10-14(4,5)9-12/h7-9,11,16H,6,10H2,1-5H3/b16-13+ |
| InChIKey | RXVXEWWZWCGAOW-DTQAZKPQSA-N |
| XLogP | 4.38 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.16 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|