C16H24BN — CID 91551904
4-[1-(cyclopropen-1-yl)ethyl-methylboranyl]-6-ethyl-6-methylcyclohepta-2,4-dien-1-imine (PubChem CID 91551904) has the molecular formula C16H24BN and a molecular weight of 241.19 g/mol. Its IUPAC name is 4-[1-(cyclopropen-1-yl)ethyl-methylboranyl]-6-ethyl-6-methylcyclohepta-2,4-dien-1-imine.
| Compound Name | 4-[1-(cyclopropen-1-yl)ethyl-methylboranyl]-6-ethyl-6-methylcyclohepta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 91551904 |
| Molecular Formula | C16H24BN |
| Molecular Weight | 241.19 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | 4-[1-(cyclopropen-1-yl)ethyl-methylboranyl]-6-ethyl-6-methylcyclohepta-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=CC(B(C)C(C)C2=CC2)=CC(C)(CC)C1 |
| InChI | InChI=1S/C16H24BN/c1-5-16(3)10-14(8-9-15(18)11-16)17(4)12(2)13-6-7-13/h6,8-10,12,18H,5,7,11H2,1-4H3/b18-15+ |
| InChIKey | MTFDUVWJVPKTGH-OBGWFSINSA-N |
| XLogP | 4.69 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.19 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|