C30H52N2 — CID 142560272
ethane;2,3,3,5,5-pentamethylocta-1,7-dien-4-imine;(5E,6Z)-2,3,3-trimethyl-5-prop-2-enylidenenona-1,6-dien-4-imine (PubChem CID 142560272) has the molecular formula C30H52N2 and a molecular weight of 440.76 g/mol. Its IUPAC name is ethane;2,3,3,5,5-pentamethylocta-1,7-dien-4-imine;(5E,6Z)-2,3,3-trimethyl-5-prop-2-enylidenenona-1,6-dien-4-imine.
| Compound Name | ethane;2,3,3,5,5-pentamethylocta-1,7-dien-4-imine;(5E,6Z)-2,3,3-trimethyl-5-prop-2-enylidenenona-1,6-dien-4-imine |
|---|---|
| PubChem CID | 142560272 |
| Molecular Formula | C30H52N2 |
| Molecular Weight | 440.76 g/mol |
| Exact Mass | 440.41 |
| IUPAC Name | ethane;2,3,3,5,5-pentamethylocta-1,7-dien-4-imine;(5E,6Z)-2,3,3-trimethyl-5-prop-2-enylidenenona-1,6-dien-4-imine |
| SMILES | CC.[H]/N=C(C(\C=C/CC)=C\C=C)/C(C)(C)C(=C)C.[H]/N=C(\C(C)(C)CC=C)C(C)(C)C(=C)C |
| InChI | InChI=1S/C15H23N.C13H23N.C2H6/c1-7-9-11-13(10-8-2)14(16)15(5,6)12(3)4;1-8-9-12(4,5)11(14)13(6,7)10(2)3;1-2/h8-11,16H,2-3,7H2,1,4-6H3;8,14H,1-2,9H2,3-7H3;1-2H3/b11-9-,13-10+,16-14+;14-11+; |
| InChIKey | UDOKNVYIZZWQCR-MXICMXOISA-N |
| XLogP | 9.92 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.76 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|