C28H39N — CID 123176685
(4Z)-8-methyl-10,11,17,20-tetramethylidenetricosa-2,4,7,18,21-pentaen-9-imine (PubChem CID 123176685) has the molecular formula C28H39N and a molecular weight of 389.63 g/mol. Its IUPAC name is (4Z)-8-methyl-10,11,17,20-tetramethylidenetricosa-2,4,7,18,21-pentaen-9-imine.
| Compound Name | (4Z)-8-methyl-10,11,17,20-tetramethylidenetricosa-2,4,7,18,21-pentaen-9-imine |
|---|---|
| PubChem CID | 123176685 |
| Molecular Formula | C28H39N |
| Molecular Weight | 389.63 g/mol |
| Exact Mass | 389.31 |
| IUPAC Name | (4Z)-8-methyl-10,11,17,20-tetramethylidenetricosa-2,4,7,18,21-pentaen-9-imine |
| SMILES | [H]/N=C(/C(=C)C(=C)CCCCCC(=C)C=CC(=C)C=CC)C(C)=CC/C=C\C=CC |
| InChI | InChI=1S/C28H39N/c1-8-10-11-12-15-20-26(6)28(29)27(7)25(5)19-16-13-14-18-24(4)22-21-23(3)17-9-2/h8-12,17,20-22,29H,3-5,7,13-16,18-19H2,1-2,6H3/b10-8?,12-11-,17-9?,22-21?,26-20?,29-28+ |
| InChIKey | MNKYEGLQIWXETA-CIORKCIHSA-N |
| XLogP | 8.78 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.63 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|