C21H31N — CID 143853907
3-buta-1,3-dien-2-yl-1-methylcyclohexa-1,3-diene;2,5,5-trimethyl-4-methylidenehex-1-en-3-imine (PubChem CID 143853907) has the molecular formula C21H31N and a molecular weight of 297.49 g/mol. Its IUPAC name is 3-buta-1,3-dien-2-yl-1-methylcyclohexa-1,3-diene;2,5,5-trimethyl-4-methylidenehex-1-en-3-imine.
| Compound Name | 3-buta-1,3-dien-2-yl-1-methylcyclohexa-1,3-diene;2,5,5-trimethyl-4-methylidenehex-1-en-3-imine |
|---|---|
| PubChem CID | 143853907 |
| Molecular Formula | C21H31N |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | 3-buta-1,3-dien-2-yl-1-methylcyclohexa-1,3-diene;2,5,5-trimethyl-4-methylidenehex-1-en-3-imine |
| SMILES | C=CC(=C)C1=CCCC(C)=C1.[H]/N=C(\C(=C)C)C(=C)C(C)(C)C |
| InChI | InChI=1S/C11H14.C10H17N/c1-4-10(3)11-7-5-6-9(2)8-11;1-7(2)9(11)8(3)10(4,5)6/h4,7-8H,1,3,5-6H2,2H3;11H,1,3H2,2,4-6H3/b;11-9+ |
| InChIKey | YNVBLHYPGVVSJX-LBOMLTECSA-N |
| XLogP | 6.58 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|