C9H13N — CID 91267490
6,6-dimethylcyclohepta-2,4-dien-1-imine (PubChem CID 91267490) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is 6,6-dimethylcyclohepta-2,4-dien-1-imine.
| Compound Name | 6,6-dimethylcyclohepta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 91267490 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 6,6-dimethylcyclohepta-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=CC=CC(C)(C)C1 |
| InChI | InChI=1S/C9H13N/c1-9(2)6-4-3-5-8(10)7-9/h3-6,10H,7H2,1-2H3/b10-8+ |
| InChIKey | OOGGITUDNHZAHC-CSKARUKUSA-N |
| XLogP | 2.55 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|