C39H79N5O3 — CID 90745627
3-[3-[bis[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]propylamino]-N-(2,2,4,4-tetramethylpentyl)propanamide (PubChem CID 90745627) has the molecular formula C39H79N5O3 and a molecular weight of 666.09 g/mol. Its IUPAC name is 3-[3-[bis[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]propylamino]-N-(2,2,4,4-tetramethylpentyl)propanamide.
| Compound Name | 3-[3-[bis[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]propylamino]-N-(2,2,4,4-tetramethylpentyl)propanamide |
|---|---|
| PubChem CID | 90745627 |
| Molecular Formula | C39H79N5O3 |
| Molecular Weight | 666.09 g/mol |
| Exact Mass | 665.62 |
| IUPAC Name | 3-[3-[bis[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]propylamino]-N-(2,2,4,4-tetramethylpentyl)propanamide |
| SMILES | CC(C)(C)CC(C)(C)CNC(=O)CCNCCCN(CCC(=O)NCC(C)(C)CC(C)(C)C)CCC(=O)NCC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C39H79N5O3/c1-34(2,3)25-37(10,11)28-41-31(45)17-21-40-20-16-22-44(23-18-32(46)42-29-38(12,13)26-35(4,5)6)24-19-33(47)43-30-39(14,15)27-36(7,8)9/h40H,16-30H2,1-15H3,(H,41,45)(H,42,46)(H,43,47) |
| InChIKey | GJCIULYVIBSYBT-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.09 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|