C18H22N2O5 — CID 90745872
2-(hydroperoxymethyl)-4-(methylideneamino)phenol;N-[4-(1-hydroperoxypropan-2-yl)phenyl]methanimine (PubChem CID 90745872) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-(hydroperoxymethyl)-4-(methylideneamino)phenol;N-[4-(1-hydroperoxypropan-2-yl)phenyl]methanimine.
| Compound Name | 2-(hydroperoxymethyl)-4-(methylideneamino)phenol;N-[4-(1-hydroperoxypropan-2-yl)phenyl]methanimine |
|---|---|
| PubChem CID | 90745872 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 2-(hydroperoxymethyl)-4-(methylideneamino)phenol;N-[4-(1-hydroperoxypropan-2-yl)phenyl]methanimine |
| SMILES | C=Nc1ccc(C(C)COO)cc1.C=Nc1ccc(O)c(COO)c1 |
| InChI | InChI=1S/C10H13NO2.C8H9NO3/c1-8(7-13-12)9-3-5-10(11-2)6-4-9;1-9-7-2-3-8(10)6(4-7)5-12-11/h3-6,8,12H,2,7H2,1H3;2-4,10-11H,1,5H2 |
| InChIKey | KMAOAUMNLZGNPB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|