About 2-nitropyrrolo[2,3-d]pyrimidin-4-one
2-nitropyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 90746023) has the molecular formula C6H2N4O3
and a molecular weight of 178.11 g/mol. Its IUPAC name is 2-nitropyrrolo[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-nitropyrrolo[2,3-d]pyrimidin-4-one |
| PubChem CID | 90746023 |
| Molecular Formula | C6H2N4O3 |
| Molecular Weight | 178.11 g/mol |
| Exact Mass | 178.01 |
| IUPAC Name | 2-nitropyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | O=C1N=C([N+](=O)[O-])N=C2N=CC=C12 |
| InChI | InChI=1S/C6H2N4O3/c11-5-3-1-2-7-4(3)8-6(9-5)10(12)13/h1-2H |
| InChIKey | VAIKXVPUWCPPER-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 97.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.11 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitropyrrolo[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitropyrrolo[2,3-d]pyrimidin-4-one?
The IUPAC name of 2-nitropyrrolo[2,3-d]pyrimidin-4-one (CID 90746023) is 2-nitropyrrolo[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 2-nitropyrrolo[2,3-d]pyrimidin-4-one?
The canonical SMILES for 2-nitropyrrolo[2,3-d]pyrimidin-4-one is O=C1N=C([N+](=O)[O-])N=C2N=CC=C12.
What is the InChIKey of 2-nitropyrrolo[2,3-d]pyrimidin-4-one?
The InChIKey is VAIKXVPUWCPPER-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2N4O3/c11-5-3-1-2-7-4(3)8-6(9-5)10(12)13/h1-2H.
What are the key properties of 2-nitropyrrolo[2,3-d]pyrimidin-4-one?
2-nitropyrrolo[2,3-d]pyrimidin-4-one has a molecular weight of 178.11 g/mol, XLogP of -0.43, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitropyrrolo[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 90746023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).