C9H16N+ — CID 90746991
1-methylidene-6-propan-2-yl-3,6-dihydro-2H-pyridin-1-ium (PubChem CID 90746991) has the molecular formula C9H16N+ and a molecular weight of 138.23 g/mol. Its IUPAC name is 1-methylidene-6-propan-2-yl-3,6-dihydro-2H-pyridin-1-ium.
| Compound Name | 1-methylidene-6-propan-2-yl-3,6-dihydro-2H-pyridin-1-ium |
|---|---|
| PubChem CID | 90746991 |
| Molecular Formula | C9H16N+ |
| Molecular Weight | 138.23 g/mol |
| Exact Mass | 138.13 |
| IUPAC Name | 1-methylidene-6-propan-2-yl-3,6-dihydro-2H-pyridin-1-ium |
| SMILES | C=[N+]1CCC=CC1C(C)C |
| InChI | InChI=1S/C9H16N/c1-8(2)9-6-4-5-7-10(9)3/h4,6,8-9H,3,5,7H2,1-2H3/q+1 |
| InChIKey | VOBMQVXVUCAZRR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|