C27H21N3O5 — CID 90747773
2-[5-formamido-4-hydroxy-9-[(3-phenoxyphenyl)methyl]pyrido[3,4-b]indol-6-yl]acetic acid (PubChem CID 90747773) has the molecular formula C27H21N3O5 and a molecular weight of 467.48 g/mol. Its IUPAC name is 2-[5-formamido-4-hydroxy-9-[(3-phenoxyphenyl)methyl]pyrido[3,4-b]indol-6-yl]acetic acid.
| Compound Name | 2-[5-formamido-4-hydroxy-9-[(3-phenoxyphenyl)methyl]pyrido[3,4-b]indol-6-yl]acetic acid |
|---|---|
| PubChem CID | 90747773 |
| Molecular Formula | C27H21N3O5 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 2-[5-formamido-4-hydroxy-9-[(3-phenoxyphenyl)methyl]pyrido[3,4-b]indol-6-yl]acetic acid |
| SMILES | O=CNc1c(CC(=O)O)ccc2c1c1c(O)cncc1n2Cc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C27H21N3O5/c31-16-29-27-18(12-24(33)34)9-10-21-26(27)25-22(13-28-14-23(25)32)30(21)15-17-5-4-8-20(11-17)35-19-6-2-1-3-7-19/h1-11,13-14,16,32H,12,15H2,(H,29,31)(H,33,34) |
| InChIKey | IRFUHAFYPOVCFM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|