C21H17N3O4 — CID 91434944
2-(9-benzyl-5-formamido-4-hydroxypyrido[3,4-b]indol-6-yl)acetic acid (PubChem CID 91434944) has the molecular formula C21H17N3O4 and a molecular weight of 375.38 g/mol. Its IUPAC name is 2-(9-benzyl-5-formamido-4-hydroxypyrido[3,4-b]indol-6-yl)acetic acid.
| Compound Name | 2-(9-benzyl-5-formamido-4-hydroxypyrido[3,4-b]indol-6-yl)acetic acid |
|---|---|
| PubChem CID | 91434944 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 2-(9-benzyl-5-formamido-4-hydroxypyrido[3,4-b]indol-6-yl)acetic acid |
| SMILES | O=CNc1c(CC(=O)O)ccc2c1c1c(O)cncc1n2Cc1ccccc1 |
| InChI | InChI=1S/C21H17N3O4/c25-12-23-21-14(8-18(27)28)6-7-15-20(21)19-16(9-22-10-17(19)26)24(15)11-13-4-2-1-3-5-13/h1-7,9-10,12,26H,8,11H2,(H,23,25)(H,27,28) |
| InChIKey | VDZVUAILNFOQGQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|