C21H16FN3O4 — CID 90834708
2-[9-[(3-fluorophenyl)methyl]-5-formamido-4-hydroxypyrido[3,4-b]indol-6-yl]acetic acid (PubChem CID 90834708) has the molecular formula C21H16FN3O4 and a molecular weight of 393.37 g/mol. Its IUPAC name is 2-[9-[(3-fluorophenyl)methyl]-5-formamido-4-hydroxypyrido[3,4-b]indol-6-yl]acetic acid.
| Compound Name | 2-[9-[(3-fluorophenyl)methyl]-5-formamido-4-hydroxypyrido[3,4-b]indol-6-yl]acetic acid |
|---|---|
| PubChem CID | 90834708 |
| Molecular Formula | C21H16FN3O4 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 2-[9-[(3-fluorophenyl)methyl]-5-formamido-4-hydroxypyrido[3,4-b]indol-6-yl]acetic acid |
| SMILES | O=CNc1c(CC(=O)O)ccc2c1c1c(O)cncc1n2Cc1cccc(F)c1 |
| InChI | InChI=1S/C21H16FN3O4/c22-14-3-1-2-12(6-14)10-25-15-5-4-13(7-18(28)29)21(24-11-26)20(15)19-16(25)8-23-9-17(19)27/h1-6,8-9,11,27H,7,10H2,(H,24,26)(H,28,29) |
| InChIKey | CFGLFYHQHXJURT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|