C20H22ClFN4O2S — CID 90747981
methyl 3-[5-[butyl-(2-fluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]-N-(1-chloroethenyl)but-2-enimidate (PubChem CID 90747981) has the molecular formula C20H22ClFN4O2S and a molecular weight of 436.94 g/mol. Its IUPAC name is methyl 3-[5-[butyl-(2-fluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]-N-(1-chloroethenyl)but-2-enimidate.
| Compound Name | methyl 3-[5-[butyl-(2-fluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]-N-(1-chloroethenyl)but-2-enimidate |
|---|---|
| PubChem CID | 90747981 |
| Molecular Formula | C20H22ClFN4O2S |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | methyl 3-[5-[butyl-(2-fluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]-N-(1-chloroethenyl)but-2-enimidate |
| SMILES | C=C(Cl)N=C(C=C(C)c1nnc(N(CCCC)C(=O)c2ccccc2F)s1)OC |
| InChI | InChI=1S/C20H22ClFN4O2S/c1-5-6-11-26(19(27)15-9-7-8-10-16(15)22)20-25-24-18(29-20)13(2)12-17(28-4)23-14(3)21/h7-10,12H,3,5-6,11H2,1-2,4H3 |
| InChIKey | YMRIOQSAXFCPPX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 67.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|