C32H40F2IO5S2+ — CID 90748544
[(4-tert-butylphenyl)-diphenyl-λ4-sulfanyl]-[1,1-difluoro-2-(8-iodooctoxy)-2-oxoethyl]sulfonyloxidanium (PubChem CID 90748544) has the molecular formula C32H40F2IO5S2+ and a molecular weight of 733.70 g/mol. Its IUPAC name is [(4-tert-butylphenyl)-diphenyl-λ4-sulfanyl]-[1,1-difluoro-2-(8-iodooctoxy)-2-oxoethyl]sulfonyloxidanium.
| Compound Name | [(4-tert-butylphenyl)-diphenyl-λ4-sulfanyl]-[1,1-difluoro-2-(8-iodooctoxy)-2-oxoethyl]sulfonyloxidanium |
|---|---|
| PubChem CID | 90748544 |
| Molecular Formula | C32H40F2IO5S2+ |
| Molecular Weight | 733.70 g/mol |
| Exact Mass | 733.13 |
| IUPAC Name | [(4-tert-butylphenyl)-diphenyl-λ4-sulfanyl]-[1,1-difluoro-2-(8-iodooctoxy)-2-oxoethyl]sulfonyloxidanium |
| SMILES | CC(C)(C)c1ccc(S([OH+]S(=O)(=O)C(F)(F)C(=O)OCCCCCCCCI)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H39F2IO5S2/c1-31(2,3)26-20-22-29(23-21-26)41(27-16-10-8-11-17-27,28-18-12-9-13-19-28)40-42(37,38)32(33,34)30(36)39-25-15-7-5-4-6-14-24-35/h8-13,16-23H,4-7,14-15,24-25H2,1-3H3/p+1 |
| InChIKey | FDCAMDWSUNOTIZ-UHFFFAOYSA-O |
| XLogP | 9.52 |
| TPSA | 73.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.70 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|